About 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate
6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate (PubChem CID 88782676) has the molecular formula C11H18N4O2S2
and a molecular weight of 302.43 g/mol. Its IUPAC name is 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate.
Molecular Properties
| Compound Name | 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate |
| PubChem CID | 88782676 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCCCCN1C(=O)C(=O)N(C)C1=S |
| InChI | InChI=1S/C11H18N4O2S2/c1-14-8(16)9(17)15(11(14)18)6-4-2-3-5-7-19-10(12)13/h2-7H2,1H3,(H3,12,13) |
| InChIKey | VUAIIGNVNAEWJJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate?
The IUPAC name of 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate (CID 88782676) is 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate.
What is the SMILES notation for 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate?
The canonical SMILES for 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate is [H]/N=C(\N)SCCCCCCN1C(=O)C(=O)N(C)C1=S.
What is the InChIKey of 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate?
The InChIKey is VUAIIGNVNAEWJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2S2/c1-14-8(16)9(17)15(11(14)18)6-4-2-3-5-7-19-10(12)13/h2-7H2,1H3,(H3,12,13).
What are the key properties of 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate?
6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate has a molecular weight of 302.43 g/mol, XLogP of 0.76, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methyl-4,5-dioxo-2-sulfanylideneimidazolidin-1-yl)hexyl carbamimidothioate is sourced from PubChem (CID 88782676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).