C20H30O2 — CID 88782700
(4Z,10E)-4,10,14-trimethyl-7-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-one (PubChem CID 88782700) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (4Z,10E)-4,10,14-trimethyl-7-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-one.
| Compound Name | (4Z,10E)-4,10,14-trimethyl-7-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-one |
|---|---|
| PubChem CID | 88782700 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4Z,10E)-4,10,14-trimethyl-7-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadeca-4,10-dien-6-one |
| SMILES | CC(C)=C1CC/C(C)=C/CCC2(C)OC2CC/C(C)=C\C1=O |
| InChI | InChI=1S/C20H30O2/c1-14(2)17-10-8-15(3)7-6-12-20(5)19(22-20)11-9-16(4)13-18(17)21/h7,13,19H,6,8-12H2,1-5H3/b15-7+,16-13- |
| InChIKey | WZIQZPPDZYHYQO-JUBBJYOSSA-N |
| XLogP | 5.30 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|