C11H11ClO4 — CID 88782894
carbonic acid;6-chloro-2,3-dihydro-1H-indene-5-carbaldehyde (PubChem CID 88782894) has the molecular formula C11H11ClO4 and a molecular weight of 242.66 g/mol. Its IUPAC name is carbonic acid;6-chloro-2,3-dihydro-1H-indene-5-carbaldehyde.
| Compound Name | carbonic acid;6-chloro-2,3-dihydro-1H-indene-5-carbaldehyde |
|---|---|
| PubChem CID | 88782894 |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | carbonic acid;6-chloro-2,3-dihydro-1H-indene-5-carbaldehyde |
| SMILES | O=C(O)O.O=Cc1cc2c(cc1Cl)CCC2 |
| InChI | InChI=1S/C10H9ClO.CH2O3/c11-10-5-8-3-1-2-7(8)4-9(10)6-12;2-1(3)4/h4-6H,1-3H2;(H2,2,3,4) |
| InChIKey | LPVSTLUFJRJQPL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|