C7H8Br4O2 — CID 88783589
(1Z,3E)-1,2,3,4-tetrabromo-5,5-dimethoxypenta-1,3-diene (PubChem CID 88783589) has the molecular formula C7H8Br4O2 and a molecular weight of 443.76 g/mol. Its IUPAC name is (1Z,3E)-1,2,3,4-tetrabromo-5,5-dimethoxypenta-1,3-diene.
| Compound Name | (1Z,3E)-1,2,3,4-tetrabromo-5,5-dimethoxypenta-1,3-diene |
|---|---|
| PubChem CID | 88783589 |
| Molecular Formula | C7H8Br4O2 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 439.73 |
| IUPAC Name | (1Z,3E)-1,2,3,4-tetrabromo-5,5-dimethoxypenta-1,3-diene |
| SMILES | COC(OC)/C(Br)=C(Br)/C(Br)=C/Br |
| InChI | InChI=1S/C7H8Br4O2/c1-12-7(13-2)6(11)5(10)4(9)3-8/h3,7H,1-2H3/b4-3-,6-5+ |
| InChIKey | VKSKJTYADZAUOP-DNVGVPOPSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|