About calcium;1-methoxyethanolate;hydroxide
calcium;1-methoxyethanolate;hydroxide (PubChem CID 88783593) has the molecular formula C3H8CaO3
and a molecular weight of 132.17 g/mol. Its IUPAC name is calcium;1-methoxyethanolate;hydroxide.
Molecular Properties
| Compound Name | calcium;1-methoxyethanolate;hydroxide |
| PubChem CID | 88783593 |
| Molecular Formula | C3H8CaO3 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | calcium;1-methoxyethanolate;hydroxide |
| SMILES | COC(C)[O-].[Ca+2].[OH-] |
| InChI | InChI=1S/C3H7O2.Ca.H2O/c1-3(4)5-2;;/h3H,1-2H3;;1H2/q-1;+2;/p-1 |
| InChIKey | CLPMSIOVYXTMEJ-UHFFFAOYSA-M |
| XLogP | -1.22 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze calcium;1-methoxyethanolate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;1-methoxyethanolate;hydroxide?
The IUPAC name of calcium;1-methoxyethanolate;hydroxide (CID 88783593) is calcium;1-methoxyethanolate;hydroxide.
What is the SMILES notation for calcium;1-methoxyethanolate;hydroxide?
The canonical SMILES for calcium;1-methoxyethanolate;hydroxide is COC(C)[O-].[Ca+2].[OH-].
What is the InChIKey of calcium;1-methoxyethanolate;hydroxide?
The InChIKey is CLPMSIOVYXTMEJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7O2.Ca.H2O/c1-3(4)5-2;;/h3H,1-2H3;;1H2/q-1;+2;/p-1.
What are the key properties of calcium;1-methoxyethanolate;hydroxide?
calcium;1-methoxyethanolate;hydroxide has a molecular weight of 132.17 g/mol, XLogP of -1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;1-methoxyethanolate;hydroxide is sourced from PubChem (CID 88783593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).