About 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium
3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium (PubChem CID 88784008) has the molecular formula C7H6BrN3O
and a molecular weight of 228.05 g/mol. Its IUPAC name is 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium.
Molecular Properties
| Compound Name | 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium |
| PubChem CID | 88784008 |
| Molecular Formula | C7H6BrN3O |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium |
| SMILES | [O-][N+]1=NN(Br)Cc2ccccc21 |
| InChI | InChI=1S/C7H6BrN3O/c8-10-5-6-3-1-2-4-7(6)11(12)9-10/h1-4H,5H2 |
| InChIKey | SMAMMTJFYACINQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium?
The IUPAC name of 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium (CID 88784008) is 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium.
What is the SMILES notation for 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium?
The canonical SMILES for 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium is [O-][N+]1=NN(Br)Cc2ccccc21.
What is the InChIKey of 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium?
The InChIKey is SMAMMTJFYACINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3O/c8-10-5-6-3-1-2-4-7(6)11(12)9-10/h1-4H,5H2.
What are the key properties of 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium?
3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium has a molecular weight of 228.05 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-oxido-4H-1,2,3-benzotriazin-1-ium is sourced from PubChem (CID 88784008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).