C17H14FN5O — CID 887844
(E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 887844) has the molecular formula C17H14FN5O and a molecular weight of 323.33 g/mol. Its IUPAC name is (E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 887844 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (E)-N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | Nc1nc(NC(=O)/C=C/c2ccc(F)cc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H14FN5O/c18-13-9-6-12(7-10-13)8-11-15(24)20-17-21-16(19)23(22-17)14-4-2-1-3-5-14/h1-11H,(H3,19,20,21,22,24)/b11-8+ |
| InChIKey | IKMJGJDDBOKWMY-DHZHZOJOSA-N |
| XLogP | 2.64 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|