About [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone
[5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone (PubChem CID 88784643) has the molecular formula C31H26ClNO6
and a molecular weight of 544.00 g/mol. Its IUPAC name is [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone |
| PubChem CID | 88784643 |
| Molecular Formula | C31H26ClNO6 |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)c1c(C)c(N)c(Cl)c(C(=O)c2ccccc2OC)c1C(=O)c1ccccc1OC |
| InChI | InChI=1S/C31H26ClNO6/c1-17-24(29(34)18-11-5-8-14-21(18)37-2)25(30(35)19-12-6-9-15-22(19)38-3)26(27(32)28(17)33)31(36)20-13-7-10-16-23(20)39-4/h5-16H,33H2,1-4H3 |
| InChIKey | RYEMDVMALOQFGE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone?
The IUPAC name of [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone (CID 88784643) is [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone.
What is the SMILES notation for [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone?
The canonical SMILES for [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone is COc1ccccc1C(=O)c1c(C)c(N)c(Cl)c(C(=O)c2ccccc2OC)c1C(=O)c1ccccc1OC.
What is the InChIKey of [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone?
The InChIKey is RYEMDVMALOQFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26ClNO6/c1-17-24(29(34)18-11-5-8-14-21(18)37-2)25(30(35)19-12-6-9-15-22(19)38-3)26(27(32)28(17)33)31(36)20-13-7-10-16-23(20)39-4/h5-16H,33H2,1-4H3.
What are the key properties of [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone?
[5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone has a molecular weight of 544.00 g/mol, XLogP of 5.95, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-4-chloro-2,3-bis(2-methoxybenzoyl)-6-methylphenyl]-(2-methoxyphenyl)methanone is sourced from PubChem (CID 88784643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).