C16H12F2O — CID 88785057
1-[2-(2,5-difluorophenyl)phenyl]but-3-yn-2-ol (PubChem CID 88785057) has the molecular formula C16H12F2O and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)phenyl]but-3-yn-2-ol.
| Compound Name | 1-[2-(2,5-difluorophenyl)phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 88785057 |
| Molecular Formula | C16H12F2O |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)phenyl]but-3-yn-2-ol |
| SMILES | C#CC(O)Cc1ccccc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C16H12F2O/c1-2-13(19)9-11-5-3-4-6-14(11)15-10-12(17)7-8-16(15)18/h1,3-8,10,13,19H,9H2 |
| InChIKey | WUXYIJUVBHCKBR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|