About [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate
[3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate (PubChem CID 88785059) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate.
Molecular Properties
| Compound Name | [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate |
| PubChem CID | 88785059 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate |
| SMILES | CC1(C)CCC(=CC2C(OC=O)C2(C)C)CC1 |
| InChI | InChI=1S/C15H24O2/c1-14(2)7-5-11(6-8-14)9-12-13(17-10-16)15(12,3)4/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | AMRLCMAEPBATGU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate?
The IUPAC name of [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate (CID 88785059) is [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate.
What is the SMILES notation for [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate?
The canonical SMILES for [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate is CC1(C)CCC(=CC2C(OC=O)C2(C)C)CC1.
What is the InChIKey of [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate?
The InChIKey is AMRLCMAEPBATGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-14(2)7-5-11(6-8-14)9-12-13(17-10-16)15(12,3)4/h9-10,12-13H,5-8H2,1-4H3.
What are the key properties of [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate?
[3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate has a molecular weight of 236.35 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4,4-dimethylcyclohexylidene)methyl]-2,2-dimethylcyclopropyl] formate is sourced from PubChem (CID 88785059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).