C18H19Cl5O3S — CID 88785083
(2,3,4,5,6-pentachlorophenyl)methyl 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylate (PubChem CID 88785083) has the molecular formula C18H19Cl5O3S and a molecular weight of 492.68 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl)methyl 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl)methyl 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88785083 |
| Molecular Formula | C18H19Cl5O3S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl)methyl 2,2-dimethyl-3-[(2-methyl-1,3-oxathiolan-2-yl)methyl]cyclopropane-1-carboxylate |
| SMILES | CC1(CC2C(C(=O)OCc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)C2(C)C)OCCS1 |
| InChI | InChI=1S/C18H19Cl5O3S/c1-17(2)9(6-18(3)26-4-5-27-18)10(17)16(24)25-7-8-11(19)13(21)15(23)14(22)12(8)20/h9-10H,4-7H2,1-3H3 |
| InChIKey | GBHLYVAMMORZSU-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|