C16H22N2O4S — CID 88785394
[(2R)-7-amino-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinolin-2-yl]methyl methanesulfonate (PubChem CID 88785394) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is [(2R)-7-amino-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinolin-2-yl]methyl methanesulfonate.
| Compound Name | [(2R)-7-amino-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinolin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88785394 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [(2R)-7-amino-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinolin-2-yl]methyl methanesulfonate |
| SMILES | CN1C[C@H](COS(C)(=O)=O)CC2c3cccc(N)c3C(=O)CC21 |
| InChI | InChI=1S/C16H22N2O4S/c1-18-8-10(9-22-23(2,20)21)6-12-11-4-3-5-13(17)16(11)15(19)7-14(12)18/h3-5,10,12,14H,6-9,17H2,1-2H3/t10-,12?,14?/m1/s1 |
| InChIKey | MUKWULVMNKJTPT-PWQPVHBWSA-N |
| XLogP | 1.24 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|