C16H29O3P — CID 88785439
1-diethoxyphosphoryl-5,9-dimethyldeca-2,4,8-triene (PubChem CID 88785439) has the molecular formula C16H29O3P and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-5,9-dimethyldeca-2,4,8-triene.
| Compound Name | 1-diethoxyphosphoryl-5,9-dimethyldeca-2,4,8-triene |
|---|---|
| PubChem CID | 88785439 |
| Molecular Formula | C16H29O3P |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-diethoxyphosphoryl-5,9-dimethyldeca-2,4,8-triene |
| SMILES | CCOP(=O)(CC=CC=C(C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C16H29O3P/c1-6-18-20(17,19-7-2)14-9-8-12-16(5)13-10-11-15(3)4/h8-9,11-12H,6-7,10,13-14H2,1-5H3 |
| InChIKey | CTPQYJNGDNHHGK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|