C8H8O5 — CID 88785660
1,7-dimethyl-2,4,6-trioxabicyclo[5.2.0]non-8-ene-3,5-dione (PubChem CID 88785660) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 1,7-dimethyl-2,4,6-trioxabicyclo[5.2.0]non-8-ene-3,5-dione.
| Compound Name | 1,7-dimethyl-2,4,6-trioxabicyclo[5.2.0]non-8-ene-3,5-dione |
|---|---|
| PubChem CID | 88785660 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 1,7-dimethyl-2,4,6-trioxabicyclo[5.2.0]non-8-ene-3,5-dione |
| SMILES | CC12C=CC1(C)OC(=O)OC(=O)O2 |
| InChI | InChI=1S/C8H8O5/c1-7-3-4-8(7,2)13-6(10)11-5(9)12-7/h3-4H,1-2H3 |
| InChIKey | PEXWZHICNRKKJP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|