C21H26O3 — CID 88786097
(2E,4E,6Z)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 88786097) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2E,4E,6Z)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 88786097 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2E,4E,6Z)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | COc1cc(/C(C)=C\C=C\C(C)=C\C(=O)O)cc2c1CCC2(C)C |
| InChI | InChI=1S/C21H26O3/c1-14(11-20(22)23)7-6-8-15(2)16-12-18-17(19(13-16)24-5)9-10-21(18,3)4/h6-8,11-13H,9-10H2,1-5H3,(H,22,23)/b7-6+,14-11+,15-8- |
| InChIKey | KHOIDVDWBMQILZ-PTFWKOHESA-N |
| XLogP | 4.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|