C17H20S — CID 88786192
4a,5a,6,6a,7,8,9,10-octahydro-4H-benzo[b]thioxanthene (PubChem CID 88786192) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is 4a,5a,6,6a,7,8,9,10-octahydro-4H-benzo[b]thioxanthene.
| Compound Name | 4a,5a,6,6a,7,8,9,10-octahydro-4H-benzo[b]thioxanthene |
|---|---|
| PubChem CID | 88786192 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4a,5a,6,6a,7,8,9,10-octahydro-4H-benzo[b]thioxanthene |
| SMILES | C1=CCC2SC3CC4CCCCC4=CC3=CC2=C1 |
| InChI | InChI=1S/C17H20S/c1-2-6-13-11-17-15(9-12(13)5-1)10-14-7-3-4-8-16(14)18-17/h3-4,7,9-10,13,16-17H,1-2,5-6,8,11H2 |
| InChIKey | LGPGFNSEECEYEA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |