About 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one
1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one (PubChem CID 88786275) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one |
| PubChem CID | 88786275 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one |
| SMILES | CCC(=O)C1=CCC(=NOOC)C=C1 |
| InChI | InChI=1S/C10H13NO3/c1-3-10(12)8-4-6-9(7-5-8)11-14-13-2/h4-6H,3,7H2,1-2H3 |
| InChIKey | FMLDLIVYPUYISB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one?
The IUPAC name of 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one (CID 88786275) is 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one.
What is the SMILES notation for 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one?
The canonical SMILES for 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one is CCC(=O)C1=CCC(=NOOC)C=C1.
What is the InChIKey of 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one?
The InChIKey is FMLDLIVYPUYISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-3-10(12)8-4-6-9(7-5-8)11-14-13-2/h4-6H,3,7H2,1-2H3.
What are the key properties of 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one?
1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one has a molecular weight of 195.22 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylperoxyiminocyclohexa-1,5-dien-1-yl)propan-1-one is sourced from PubChem (CID 88786275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).