About 1,3-dibutyl-7H-purine-2,6-dithione
1,3-dibutyl-7H-purine-2,6-dithione (PubChem CID 88786372) has the molecular formula C13H20N4S2
and a molecular weight of 296.46 g/mol. Its IUPAC name is 1,3-dibutyl-7H-purine-2,6-dithione.
Molecular Properties
| Compound Name | 1,3-dibutyl-7H-purine-2,6-dithione |
| PubChem CID | 88786372 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1,3-dibutyl-7H-purine-2,6-dithione |
| SMILES | CCCCn1c(=S)c2[nH]cnc2n(CCCC)c1=S |
| InChI | InChI=1S/C13H20N4S2/c1-3-5-7-16-11-10(14-9-15-11)12(18)17(13(16)19)8-6-4-2/h9H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | KPCMSTDVYQWCEV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibutyl-7H-purine-2,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibutyl-7H-purine-2,6-dithione?
The IUPAC name of 1,3-dibutyl-7H-purine-2,6-dithione (CID 88786372) is 1,3-dibutyl-7H-purine-2,6-dithione.
What is the SMILES notation for 1,3-dibutyl-7H-purine-2,6-dithione?
The canonical SMILES for 1,3-dibutyl-7H-purine-2,6-dithione is CCCCn1c(=S)c2[nH]cnc2n(CCCC)c1=S.
What is the InChIKey of 1,3-dibutyl-7H-purine-2,6-dithione?
The InChIKey is KPCMSTDVYQWCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4S2/c1-3-5-7-16-11-10(14-9-15-11)12(18)17(13(16)19)8-6-4-2/h9H,3-8H2,1-2H3,(H,14,15).
What are the key properties of 1,3-dibutyl-7H-purine-2,6-dithione?
1,3-dibutyl-7H-purine-2,6-dithione has a molecular weight of 296.46 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutyl-7H-purine-2,6-dithione is sourced from PubChem (CID 88786372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).