C9H17NO5 — CID 88787004
(3S,4R,5S)-1,3,4,5-tetrahydroxy-6-(prop-2-enylamino)hexan-2-one (PubChem CID 88787004) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is (3S,4R,5S)-1,3,4,5-tetrahydroxy-6-(prop-2-enylamino)hexan-2-one.
| Compound Name | (3S,4R,5S)-1,3,4,5-tetrahydroxy-6-(prop-2-enylamino)hexan-2-one |
|---|---|
| PubChem CID | 88787004 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (3S,4R,5S)-1,3,4,5-tetrahydroxy-6-(prop-2-enylamino)hexan-2-one |
| SMILES | C=CCNC[C@H](O)[C@@H](O)[C@H](O)C(=O)CO |
| InChI | InChI=1S/C9H17NO5/c1-2-3-10-4-6(12)8(14)9(15)7(13)5-11/h2,6,8-12,14-15H,1,3-5H2/t6-,8+,9+/m0/s1 |
| InChIKey | DSLDEEPFLMFHFZ-NBEYISGCSA-N |
| XLogP | -2.59 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|