About 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine
1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine (PubChem CID 88787664) has the molecular formula C7H5BN2O3S
and a molecular weight of 208.01 g/mol. Its IUPAC name is 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine.
Molecular Properties
| Compound Name | 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine |
| PubChem CID | 88787664 |
| Molecular Formula | C7H5BN2O3S |
| Molecular Weight | 208.01 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine |
| SMILES | O=S(=O)=C1N=NB(O)c2ccccc21 |
| InChI | InChI=1S/C7H5BN2O3S/c11-8-6-4-2-1-3-5(6)7(9-10-8)14(12)13/h1-4,11H |
| InChIKey | TUQZOORQWWQACR-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.01 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine?
The IUPAC name of 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine (CID 88787664) is 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine.
What is the SMILES notation for 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine?
The canonical SMILES for 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine is O=S(=O)=C1N=NB(O)c2ccccc21.
What is the InChIKey of 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine?
The InChIKey is TUQZOORQWWQACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BN2O3S/c11-8-6-4-2-1-3-5(6)7(9-10-8)14(12)13/h1-4,11H.
What are the key properties of 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine?
1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine has a molecular weight of 208.01 g/mol, XLogP of -0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-4-sulfonyl-2,3,1-benzodiazaborinine is sourced from PubChem (CID 88787664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).