About (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine
(4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine (PubChem CID 88787731) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine.
Molecular Properties
| Compound Name | (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine |
| PubChem CID | 88787731 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine |
| SMILES | NNC1=CN(O)C=c2ccccc2=N1 |
| InChI | InChI=1S/C9H10N4O/c10-12-9-6-13(14)5-7-3-1-2-4-8(7)11-9/h1-6,12,14H,10H2 |
| InChIKey | SADAAMMPVSGYPK-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine?
The IUPAC name of (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine (CID 88787731) is (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine.
What is the SMILES notation for (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine?
The canonical SMILES for (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine is NNC1=CN(O)C=c2ccccc2=N1.
What is the InChIKey of (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine?
The InChIKey is SADAAMMPVSGYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c10-12-9-6-13(14)5-7-3-1-2-4-8(7)11-9/h1-6,12,14H,10H2.
What are the key properties of (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine?
(4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine has a molecular weight of 190.21 g/mol, XLogP of -0.99, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-1,4-benzodiazepin-2-yl)hydrazine is sourced from PubChem (CID 88787731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).