C19H28O3 — CID 88788209
(2E,4E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)penta-2,4-dienal (PubChem CID 88788209) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)penta-2,4-dienal.
| Compound Name | (2E,4E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 88788209 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2E,4E)-3-methyl-5-(2,5,5-trimethyl-3-oxo-4-pentoxycyclopenten-1-yl)penta-2,4-dienal |
| SMILES | CCCCCOC1C(=O)C(C)=C(/C=C/C(C)=C/C=O)C1(C)C |
| InChI | InChI=1S/C19H28O3/c1-6-7-8-13-22-18-17(21)15(3)16(19(18,4)5)10-9-14(2)11-12-20/h9-12,18H,6-8,13H2,1-5H3/b10-9+,14-11+ |
| InChIKey | VIHUVZYWSLQDGH-QDCWQMMGSA-N |
| XLogP | 4.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|