About 5-phenyl-1H-triazole-2,3-dicarbaldehyde
5-phenyl-1H-triazole-2,3-dicarbaldehyde (PubChem CID 88788371) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-phenyl-1H-triazole-2,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 5-phenyl-1H-triazole-2,3-dicarbaldehyde |
| PubChem CID | 88788371 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 5-phenyl-1H-triazole-2,3-dicarbaldehyde |
| SMILES | O=CN1C=C(c2ccccc2)NN1C=O |
| InChI | InChI=1S/C10H9N3O2/c14-7-12-6-10(11-13(12)8-15)9-4-2-1-3-5-9/h1-8,11H |
| InChIKey | DQHQOWAZTCYRNH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1H-triazole-2,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1H-triazole-2,3-dicarbaldehyde?
The IUPAC name of 5-phenyl-1H-triazole-2,3-dicarbaldehyde (CID 88788371) is 5-phenyl-1H-triazole-2,3-dicarbaldehyde.
What is the SMILES notation for 5-phenyl-1H-triazole-2,3-dicarbaldehyde?
The canonical SMILES for 5-phenyl-1H-triazole-2,3-dicarbaldehyde is O=CN1C=C(c2ccccc2)NN1C=O.
What is the InChIKey of 5-phenyl-1H-triazole-2,3-dicarbaldehyde?
The InChIKey is DQHQOWAZTCYRNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c14-7-12-6-10(11-13(12)8-15)9-4-2-1-3-5-9/h1-8,11H.
What are the key properties of 5-phenyl-1H-triazole-2,3-dicarbaldehyde?
5-phenyl-1H-triazole-2,3-dicarbaldehyde has a molecular weight of 203.20 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1H-triazole-2,3-dicarbaldehyde is sourced from PubChem (CID 88788371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).