C18H18Cl6N2O7S2 — CID 88788533
thionyl dichloride;2,2,2-trichloroethyl 2-(2-acetamido-2-chlorosulfinyl-4-oxo-3-phenoxyazetidin-1-yl)-3-methylbut-3-enoate (PubChem CID 88788533) has the molecular formula C18H18Cl6N2O7S2 and a molecular weight of 651.20 g/mol. Its IUPAC name is thionyl dichloride;2,2,2-trichloroethyl 2-(2-acetamido-2-chlorosulfinyl-4-oxo-3-phenoxyazetidin-1-yl)-3-methylbut-3-enoate.
| Compound Name | thionyl dichloride;2,2,2-trichloroethyl 2-(2-acetamido-2-chlorosulfinyl-4-oxo-3-phenoxyazetidin-1-yl)-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 88788533 |
| Molecular Formula | C18H18Cl6N2O7S2 |
| Molecular Weight | 651.20 g/mol |
| Exact Mass | 647.87 |
| IUPAC Name | thionyl dichloride;2,2,2-trichloroethyl 2-(2-acetamido-2-chlorosulfinyl-4-oxo-3-phenoxyazetidin-1-yl)-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)C(Oc2ccccc2)C1(NC(C)=O)S(=O)Cl.O=S(Cl)Cl |
| InChI | InChI=1S/C18H18Cl4N2O6S.Cl2OS/c1-10(2)13(16(27)29-9-17(19,20)21)24-15(26)14(30-12-7-5-4-6-8-12)18(24,31(22)28)23-11(3)25;1-4(2)3/h4-8,13-14H,1,9H2,2-3H3,(H,23,25); |
| InChIKey | QEHBTBKBNPDDBS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|