About (3-amino-2,4-diethyl-6-formylphenyl) acetate
(3-amino-2,4-diethyl-6-formylphenyl) acetate (PubChem CID 88788677) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is (3-amino-2,4-diethyl-6-formylphenyl) acetate.
Molecular Properties
| Compound Name | (3-amino-2,4-diethyl-6-formylphenyl) acetate |
| PubChem CID | 88788677 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (3-amino-2,4-diethyl-6-formylphenyl) acetate |
| SMILES | CCc1cc(C=O)c(OC(C)=O)c(CC)c1N |
| InChI | InChI=1S/C13H17NO3/c1-4-9-6-10(7-15)13(17-8(3)16)11(5-2)12(9)14/h6-7H,4-5,14H2,1-3H3 |
| InChIKey | DRXFMPZFANUNDU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-2,4-diethyl-6-formylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2,4-diethyl-6-formylphenyl) acetate?
The IUPAC name of (3-amino-2,4-diethyl-6-formylphenyl) acetate (CID 88788677) is (3-amino-2,4-diethyl-6-formylphenyl) acetate.
What is the SMILES notation for (3-amino-2,4-diethyl-6-formylphenyl) acetate?
The canonical SMILES for (3-amino-2,4-diethyl-6-formylphenyl) acetate is CCc1cc(C=O)c(OC(C)=O)c(CC)c1N.
What is the InChIKey of (3-amino-2,4-diethyl-6-formylphenyl) acetate?
The InChIKey is DRXFMPZFANUNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-4-9-6-10(7-15)13(17-8(3)16)11(5-2)12(9)14/h6-7H,4-5,14H2,1-3H3.
What are the key properties of (3-amino-2,4-diethyl-6-formylphenyl) acetate?
(3-amino-2,4-diethyl-6-formylphenyl) acetate has a molecular weight of 235.28 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2,4-diethyl-6-formylphenyl) acetate is sourced from PubChem (CID 88788677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).