C17H21NO — CID 88788850
4-(4a,7,8,9-tetrahydrodibenzofuran-2-yl)piperidine (PubChem CID 88788850) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-(4a,7,8,9-tetrahydrodibenzofuran-2-yl)piperidine.
| Compound Name | 4-(4a,7,8,9-tetrahydrodibenzofuran-2-yl)piperidine |
|---|---|
| PubChem CID | 88788850 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-(4a,7,8,9-tetrahydrodibenzofuran-2-yl)piperidine |
| SMILES | C1=CC2OC3=CCCCC3=C2C=C1C1CCNCC1 |
| InChI | InChI=1S/C17H21NO/c1-2-4-16-14(3-1)15-11-13(5-6-17(15)19-16)12-7-9-18-10-8-12/h4-6,11-12,17-18H,1-3,7-10H2 |
| InChIKey | QKOMWQOCKDIRCK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |