About 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid
2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid (PubChem CID 88789180) has the molecular formula C12H17NO6S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid |
| PubChem CID | 88789180 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.Cc1cc(N)c(S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C8H11NO3S.C4H6O3/c1-5-3-7(9)8(4-6(5)2)13(10,11)12;1-3(5)2-4(6)7/h3-4H,9H2,1-2H3,(H,10,11,12);2H2,1H3,(H,6,7) |
| InChIKey | YQPZSPFZHHEVGU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid?
The IUPAC name of 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid (CID 88789180) is 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid.
What is the SMILES notation for 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid?
The canonical SMILES for 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid is CC(=O)CC(=O)O.Cc1cc(N)c(S(=O)(=O)O)cc1C.
What is the InChIKey of 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid?
The InChIKey is YQPZSPFZHHEVGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S.C4H6O3/c1-5-3-7(9)8(4-6(5)2)13(10,11)12;1-3(5)2-4(6)7/h3-4H,9H2,1-2H3,(H,10,11,12);2H2,1H3,(H,6,7).
What are the key properties of 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid?
2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid has a molecular weight of 303.34 g/mol, XLogP of 1.18, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethylbenzenesulfonic acid;3-oxobutanoic acid is sourced from PubChem (CID 88789180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).