C14H27NO — CID 88789401
(4E,8E)-10-amino-2,2,4,8-tetramethyldeca-4,8-dien-1-ol (PubChem CID 88789401) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (4E,8E)-10-amino-2,2,4,8-tetramethyldeca-4,8-dien-1-ol.
| Compound Name | (4E,8E)-10-amino-2,2,4,8-tetramethyldeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 88789401 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (4E,8E)-10-amino-2,2,4,8-tetramethyldeca-4,8-dien-1-ol |
| SMILES | C/C(=C\CN)CC/C=C(\C)CC(C)(C)CO |
| InChI | InChI=1S/C14H27NO/c1-12(8-9-15)6-5-7-13(2)10-14(3,4)11-16/h7-8,16H,5-6,9-11,15H2,1-4H3/b12-8+,13-7+ |
| InChIKey | HILPVXXKDFJBCO-SWZPTJTJSA-N |
| XLogP | 3.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|