About imidazolidine-2,4,5-trione;isocyanic acid
imidazolidine-2,4,5-trione;isocyanic acid (PubChem CID 88789640) has the molecular formula C5H4N4O5
and a molecular weight of 200.11 g/mol. Its IUPAC name is imidazolidine-2,4,5-trione;isocyanic acid.
Molecular Properties
| Compound Name | imidazolidine-2,4,5-trione;isocyanic acid |
| PubChem CID | 88789640 |
| Molecular Formula | C5H4N4O5 |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | imidazolidine-2,4,5-trione;isocyanic acid |
| SMILES | N=C=O.N=C=O.O=C1NC(=O)C(=O)N1 |
| InChI | InChI=1S/C3H2N2O3.2CHNO/c6-1-2(7)5-3(8)4-1;2*2-1-3/h(H2,4,5,6,7,8);2*2H |
| InChIKey | ZJDLQDHLFDJFQK-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 157.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze imidazolidine-2,4,5-trione;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidine-2,4,5-trione;isocyanic acid?
The IUPAC name of imidazolidine-2,4,5-trione;isocyanic acid (CID 88789640) is imidazolidine-2,4,5-trione;isocyanic acid.
What is the SMILES notation for imidazolidine-2,4,5-trione;isocyanic acid?
The canonical SMILES for imidazolidine-2,4,5-trione;isocyanic acid is N=C=O.N=C=O.O=C1NC(=O)C(=O)N1.
What is the InChIKey of imidazolidine-2,4,5-trione;isocyanic acid?
The InChIKey is ZJDLQDHLFDJFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N2O3.2CHNO/c6-1-2(7)5-3(8)4-1;2*2-1-3/h(H2,4,5,6,7,8);2*2H.
What are the key properties of imidazolidine-2,4,5-trione;isocyanic acid?
imidazolidine-2,4,5-trione;isocyanic acid has a molecular weight of 200.11 g/mol, XLogP of -1.85, 0 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine-2,4,5-trione;isocyanic acid is sourced from PubChem (CID 88789640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).