About [4-(2,6-dioxooxan-3-yl)phenyl] acetate
[4-(2,6-dioxooxan-3-yl)phenyl] acetate (PubChem CID 88789731) has the molecular formula C13H12O5
and a molecular weight of 248.23 g/mol. Its IUPAC name is [4-(2,6-dioxooxan-3-yl)phenyl] acetate.
Molecular Properties
| Compound Name | [4-(2,6-dioxooxan-3-yl)phenyl] acetate |
| PubChem CID | 88789731 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | [4-(2,6-dioxooxan-3-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2CCC(=O)OC2=O)cc1 |
| InChI | InChI=1S/C13H12O5/c1-8(14)17-10-4-2-9(3-5-10)11-6-7-12(15)18-13(11)16/h2-5,11H,6-7H2,1H3 |
| InChIKey | RXXINMUWCJVRBG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,6-dioxooxan-3-yl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,6-dioxooxan-3-yl)phenyl] acetate?
The IUPAC name of [4-(2,6-dioxooxan-3-yl)phenyl] acetate (CID 88789731) is [4-(2,6-dioxooxan-3-yl)phenyl] acetate.
What is the SMILES notation for [4-(2,6-dioxooxan-3-yl)phenyl] acetate?
The canonical SMILES for [4-(2,6-dioxooxan-3-yl)phenyl] acetate is CC(=O)Oc1ccc(C2CCC(=O)OC2=O)cc1.
What is the InChIKey of [4-(2,6-dioxooxan-3-yl)phenyl] acetate?
The InChIKey is RXXINMUWCJVRBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5/c1-8(14)17-10-4-2-9(3-5-10)11-6-7-12(15)18-13(11)16/h2-5,11H,6-7H2,1H3.
What are the key properties of [4-(2,6-dioxooxan-3-yl)phenyl] acetate?
[4-(2,6-dioxooxan-3-yl)phenyl] acetate has a molecular weight of 248.23 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,6-dioxooxan-3-yl)phenyl] acetate is sourced from PubChem (CID 88789731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).