About 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol
1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol (PubChem CID 88789774) has the molecular formula C14H26OS2
and a molecular weight of 274.49 g/mol. Its IUPAC name is 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol.
Molecular Properties
| Compound Name | 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol |
| PubChem CID | 88789774 |
| Molecular Formula | C14H26OS2 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol |
| SMILES | CCCCCCC(O)C=CCC1SCC(C)S1 |
| InChI | InChI=1S/C14H26OS2/c1-3-4-5-6-8-13(15)9-7-10-14-16-11-12(2)17-14/h7,9,12-15H,3-6,8,10-11H2,1-2H3 |
| InChIKey | MPOGPVDONKIGQT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol?
The IUPAC name of 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol (CID 88789774) is 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol.
What is the SMILES notation for 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol?
The canonical SMILES for 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol is CCCCCCC(O)C=CCC1SCC(C)S1.
What is the InChIKey of 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol?
The InChIKey is MPOGPVDONKIGQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26OS2/c1-3-4-5-6-8-13(15)9-7-10-14-16-11-12(2)17-14/h7,9,12-15H,3-6,8,10-11H2,1-2H3.
What are the key properties of 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol?
1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol has a molecular weight of 274.49 g/mol, XLogP of 4.46, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,3-dithiolan-2-yl)dec-2-en-4-ol is sourced from PubChem (CID 88789774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).