About trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane
trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane (PubChem CID 88789838) has the molecular formula C15H22OSi
and a molecular weight of 246.43 g/mol. Its IUPAC name is trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane.
Molecular Properties
| Compound Name | trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane |
| PubChem CID | 88789838 |
| Molecular Formula | C15H22OSi |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane |
| SMILES | C#CC(O[Si](C)(C)C)C(=C)C(=C)C(=C)C(=C)C |
| InChI | InChI=1S/C15H22OSi/c1-10-15(16-17(7,8)9)14(6)13(5)12(4)11(2)3/h1,15H,2,4-6H2,3,7-9H3 |
| InChIKey | JNVLBWKRHFONHB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane?
The IUPAC name of trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane (CID 88789838) is trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane.
What is the SMILES notation for trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane?
The canonical SMILES for trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane is C#CC(O[Si](C)(C)C)C(=C)C(=C)C(=C)C(=C)C.
What is the InChIKey of trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane?
The InChIKey is JNVLBWKRHFONHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22OSi/c1-10-15(16-17(7,8)9)14(6)13(5)12(4)11(2)3/h1,15H,2,4-6H2,3,7-9H3.
What are the key properties of trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane?
trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane has a molecular weight of 246.43 g/mol, XLogP of 4.08, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(7-methyl-4,5,6-trimethylideneoct-7-en-1-yn-3-yl)oxysilane is sourced from PubChem (CID 88789838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).