About (E)-2,4,4-trimethyl-6-oxohept-2-enamide
(E)-2,4,4-trimethyl-6-oxohept-2-enamide (PubChem CID 88789893) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (E)-2,4,4-trimethyl-6-oxohept-2-enamide.
Molecular Properties
| Compound Name | (E)-2,4,4-trimethyl-6-oxohept-2-enamide |
| PubChem CID | 88789893 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (E)-2,4,4-trimethyl-6-oxohept-2-enamide |
| SMILES | CC(=O)CC(C)(C)/C=C(\C)C(N)=O |
| InChI | InChI=1S/C10H17NO2/c1-7(9(11)13)5-10(3,4)6-8(2)12/h5H,6H2,1-4H3,(H2,11,13)/b7-5+ |
| InChIKey | BODHDGFMWRFULJ-FNORWQNLSA-N |
| XLogP | 1.42 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,4,4-trimethyl-6-oxohept-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,4,4-trimethyl-6-oxohept-2-enamide?
The IUPAC name of (E)-2,4,4-trimethyl-6-oxohept-2-enamide (CID 88789893) is (E)-2,4,4-trimethyl-6-oxohept-2-enamide.
What is the SMILES notation for (E)-2,4,4-trimethyl-6-oxohept-2-enamide?
The canonical SMILES for (E)-2,4,4-trimethyl-6-oxohept-2-enamide is CC(=O)CC(C)(C)/C=C(\C)C(N)=O.
What is the InChIKey of (E)-2,4,4-trimethyl-6-oxohept-2-enamide?
The InChIKey is BODHDGFMWRFULJ-FNORWQNLSA-N. The full InChI is InChI=1S/C10H17NO2/c1-7(9(11)13)5-10(3,4)6-8(2)12/h5H,6H2,1-4H3,(H2,11,13)/b7-5+.
What are the key properties of (E)-2,4,4-trimethyl-6-oxohept-2-enamide?
(E)-2,4,4-trimethyl-6-oxohept-2-enamide has a molecular weight of 183.25 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4,4-trimethyl-6-oxohept-2-enamide is sourced from PubChem (CID 88789893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).