C19H19N5O2S2 — CID 8879004
N'-[(2S)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide (PubChem CID 8879004) has the molecular formula C19H19N5O2S2 and a molecular weight of 413.53 g/mol. Its IUPAC name is N'-[(2S)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide.
| Compound Name | N'-[(2S)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 8879004 |
| Molecular Formula | C19H19N5O2S2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N'-[(2S)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide |
| SMILES | C[C@H](Sc1nnc(-c2cccs2)n1C1CC1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N5O2S2/c1-12(17(25)21-22-18(26)13-6-3-2-4-7-13)28-19-23-20-16(15-8-5-11-27-15)24(19)14-9-10-14/h2-8,11-12,14H,9-10H2,1H3,(H,21,25)(H,22,26)/t12-/m0/s1 |
| InChIKey | ZJLLJVGYAFWRFX-LBPRGKRZSA-N |
| XLogP | 3.28 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|