C22H31NO2 — CID 88790237
methyl (2E,4E,6E)-9-[4-(dimethylamino)-2,6-dimethylphenyl]-3,7-dimethylnona-2,4,6-trienoate (PubChem CID 88790237) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is methyl (2E,4E,6E)-9-[4-(dimethylamino)-2,6-dimethylphenyl]-3,7-dimethylnona-2,4,6-trienoate.
| Compound Name | methyl (2E,4E,6E)-9-[4-(dimethylamino)-2,6-dimethylphenyl]-3,7-dimethylnona-2,4,6-trienoate |
|---|---|
| PubChem CID | 88790237 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | methyl (2E,4E,6E)-9-[4-(dimethylamino)-2,6-dimethylphenyl]-3,7-dimethylnona-2,4,6-trienoate |
| SMILES | COC(=O)/C=C(C)/C=C/C=C(\C)CCc1c(C)cc(N(C)C)cc1C |
| InChI | InChI=1S/C22H31NO2/c1-16(9-8-10-17(2)13-22(24)25-7)11-12-21-18(3)14-20(23(5)6)15-19(21)4/h8-10,13-15H,11-12H2,1-7H3/b10-8+,16-9+,17-13+ |
| InChIKey | YILVHLHLHWMCKW-LJUGQVFKSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|