About 2-(N-propylanilino)ethyl N-cyclohexylsulfamate
2-(N-propylanilino)ethyl N-cyclohexylsulfamate (PubChem CID 88790269) has the molecular formula C17H28N2O3S
and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-(N-propylanilino)ethyl N-cyclohexylsulfamate.
Molecular Properties
| Compound Name | 2-(N-propylanilino)ethyl N-cyclohexylsulfamate |
| PubChem CID | 88790269 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-(N-propylanilino)ethyl N-cyclohexylsulfamate |
| SMILES | CCCN(CCOS(=O)(=O)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O3S/c1-2-13-19(17-11-7-4-8-12-17)14-15-22-23(20,21)18-16-9-5-3-6-10-16/h4,7-8,11-12,16,18H,2-3,5-6,9-10,13-15H2,1H3 |
| InChIKey | KKRVIMFLMONRRE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(N-propylanilino)ethyl N-cyclohexylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-propylanilino)ethyl N-cyclohexylsulfamate?
The IUPAC name of 2-(N-propylanilino)ethyl N-cyclohexylsulfamate (CID 88790269) is 2-(N-propylanilino)ethyl N-cyclohexylsulfamate.
What is the SMILES notation for 2-(N-propylanilino)ethyl N-cyclohexylsulfamate?
The canonical SMILES for 2-(N-propylanilino)ethyl N-cyclohexylsulfamate is CCCN(CCOS(=O)(=O)NC1CCCCC1)c1ccccc1.
What is the InChIKey of 2-(N-propylanilino)ethyl N-cyclohexylsulfamate?
The InChIKey is KKRVIMFLMONRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O3S/c1-2-13-19(17-11-7-4-8-12-17)14-15-22-23(20,21)18-16-9-5-3-6-10-16/h4,7-8,11-12,16,18H,2-3,5-6,9-10,13-15H2,1H3.
What are the key properties of 2-(N-propylanilino)ethyl N-cyclohexylsulfamate?
2-(N-propylanilino)ethyl N-cyclohexylsulfamate has a molecular weight of 340.49 g/mol, XLogP of 3.09, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-propylanilino)ethyl N-cyclohexylsulfamate is sourced from PubChem (CID 88790269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).