C14H23FeN8 — CID 88790343
N'-[2-(dimethylamino)ethyl]-N,N,N'-trimethylethane-1,2-diamine;iron(5+);pentacyanide (PubChem CID 88790343) has the molecular formula C14H23FeN8 and a molecular weight of 359.24 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N,N,N'-trimethylethane-1,2-diamine;iron(5+);pentacyanide.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N,N,N'-trimethylethane-1,2-diamine;iron(5+);pentacyanide |
|---|---|
| PubChem CID | 88790343 |
| Molecular Formula | C14H23FeN8 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N,N,N'-trimethylethane-1,2-diamine;iron(5+);pentacyanide |
| SMILES | CN(C)CCN(C)CCN(C)C.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[Fe+5] |
| InChI | InChI=1S/C9H23N3.5CN.Fe/c1-10(2)6-8-12(5)9-7-11(3)4;5*1-2;/h6-9H2,1-5H3;;;;;;/q;5*-1;+5 |
| InChIKey | CUHCQKRJXCCZAR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 128.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|