C28H16F6O14 — CID 88790526
cyclopentane-1,1,2,2-tetracarboxylic acid;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione (PubChem CID 88790526) has the molecular formula C28H16F6O14 and a molecular weight of 690.41 g/mol. Its IUPAC name is cyclopentane-1,1,2,2-tetracarboxylic acid;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione.
| Compound Name | cyclopentane-1,1,2,2-tetracarboxylic acid;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88790526 |
| Molecular Formula | C28H16F6O14 |
| Molecular Weight | 690.41 g/mol |
| Exact Mass | 690.04 |
| IUPAC Name | cyclopentane-1,1,2,2-tetracarboxylic acid;5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione |
| SMILES | O=C(O)C1(C(=O)O)CCCC1(C(=O)O)C(=O)O.O=C1OC(=O)c2cc(C(c3ccc4c(c3)C(=O)OC4=O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H6F6O6.C9H10O8/c20-18(21,22)17(19(23,24)25,7-1-3-9-11(5-7)15(28)30-13(9)26)8-2-4-10-12(6-8)16(29)31-14(10)27;10-4(11)8(5(12)13)2-1-3-9(8,6(14)15)7(16)17/h1-6H;1-3H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | AQZGANKOLBGMKL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 235.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|