C15H24FeN7 — CID 88790663
iron(5+);N,N,N',N'-tetraethylethane-1,2-diamine;pentacyanide (PubChem CID 88790663) has the molecular formula C15H24FeN7 and a molecular weight of 358.25 g/mol. Its IUPAC name is iron(5+);N,N,N',N'-tetraethylethane-1,2-diamine;pentacyanide.
| Compound Name | iron(5+);N,N,N',N'-tetraethylethane-1,2-diamine;pentacyanide |
|---|---|
| PubChem CID | 88790663 |
| Molecular Formula | C15H24FeN7 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | iron(5+);N,N,N',N'-tetraethylethane-1,2-diamine;pentacyanide |
| SMILES | CCN(CC)CCN(CC)CC.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[Fe+5] |
| InChI | InChI=1S/C10H24N2.5CN.Fe/c1-5-11(6-2)9-10-12(7-3)8-4;5*1-2;/h5-10H2,1-4H3;;;;;;/q;5*-1;+5 |
| InChIKey | FGKLNRMLKQTHTB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 125.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|