About triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane
triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane (PubChem CID 88790838) has the molecular formula C27H56OSiSn
and a molecular weight of 543.54 g/mol. Its IUPAC name is triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane |
| PubChem CID | 88790838 |
| Molecular Formula | C27H56OSiSn |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane |
| SMILES | CCC=CC(C)(C/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H29OSi.3C4H9.Sn/c1-7-12-14-15(6,13-8-2)16-17(9-3,10-4)11-5;3*1-3-4-2;/h2,8,12,14H,7,9-11,13H2,1,3-6H3;3*1,3-4H2,2H3; |
| InChIKey | FRVOIWPVXWNFTI-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane?
The IUPAC name of triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane (CID 88790838) is triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane.
What is the SMILES notation for triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane?
The canonical SMILES for triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane is CCC=CC(C)(C/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane?
The InChIKey is FRVOIWPVXWNFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29OSi.3C4H9.Sn/c1-7-12-14-15(6,13-8-2)16-17(9-3,10-4)11-5;3*1-3-4-2;/h2,8,12,14H,7,9-11,13H2,1,3-6H3;3*1,3-4H2,2H3;.
What are the key properties of triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane?
triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane has a molecular weight of 543.54 g/mol, XLogP of 10.07, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(1E)-4-methyl-1-tributylstannylocta-1,5-dien-4-yl]oxysilane is sourced from PubChem (CID 88790838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).