About naphthalene-1-carbaldehyde;zinc
naphthalene-1-carbaldehyde;zinc (PubChem CID 88790891) has the molecular formula C11H8OZn
and a molecular weight of 221.57 g/mol. Its IUPAC name is naphthalene-1-carbaldehyde;zinc.
Molecular Properties
| Compound Name | naphthalene-1-carbaldehyde;zinc |
| PubChem CID | 88790891 |
| Molecular Formula | C11H8OZn |
| Molecular Weight | 221.57 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | naphthalene-1-carbaldehyde;zinc |
| SMILES | O=Cc1cccc2ccccc12.[Zn] |
| InChI | InChI=1S/C11H8O.Zn/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-8H; |
| InChIKey | GKSFMASPWPCZPR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1-carbaldehyde;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1-carbaldehyde;zinc?
The IUPAC name of naphthalene-1-carbaldehyde;zinc (CID 88790891) is naphthalene-1-carbaldehyde;zinc.
What is the SMILES notation for naphthalene-1-carbaldehyde;zinc?
The canonical SMILES for naphthalene-1-carbaldehyde;zinc is O=Cc1cccc2ccccc12.[Zn].
What is the InChIKey of naphthalene-1-carbaldehyde;zinc?
The InChIKey is GKSFMASPWPCZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O.Zn/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-8H;.
What are the key properties of naphthalene-1-carbaldehyde;zinc?
naphthalene-1-carbaldehyde;zinc has a molecular weight of 221.57 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1-carbaldehyde;zinc is sourced from PubChem (CID 88790891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).