C17H31N3S2 — CID 88791364
1-(5-cyclododecyl-4-methyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol (PubChem CID 88791364) has the molecular formula C17H31N3S2 and a molecular weight of 341.59 g/mol. Its IUPAC name is 1-(5-cyclododecyl-4-methyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol.
| Compound Name | 1-(5-cyclododecyl-4-methyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 88791364 |
| Molecular Formula | C17H31N3S2 |
| Molecular Weight | 341.59 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-(5-cyclododecyl-4-methyl-1,2,4-triazol-3-yl)ethane-1,2-dithiol |
| SMILES | Cn1c(C(S)CS)nnc1C1CCCCCCCCCCC1 |
| InChI | InChI=1S/C17H31N3S2/c1-20-16(18-19-17(20)15(22)13-21)14-11-9-7-5-3-2-4-6-8-10-12-14/h14-15,21-22H,2-13H2,1H3 |
| InChIKey | WNJUQWPUXWHXHN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|