About 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea
3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea (PubChem CID 88791451) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea.
Molecular Properties
| Compound Name | 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea |
| PubChem CID | 88791451 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea |
| SMILES | CCNC(=O)N(S)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C12H18N2OS/c1-5-13-12(15)14(16)11-7-9(3)8(2)6-10(11)4/h6-7,16H,5H2,1-4H3,(H,13,15) |
| InChIKey | QKMDAQNNUJVTPM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea?
The IUPAC name of 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea (CID 88791451) is 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea.
What is the SMILES notation for 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea?
The canonical SMILES for 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea is CCNC(=O)N(S)c1cc(C)c(C)cc1C.
What is the InChIKey of 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea?
The InChIKey is QKMDAQNNUJVTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2OS/c1-5-13-12(15)14(16)11-7-9(3)8(2)6-10(11)4/h6-7,16H,5H2,1-4H3,(H,13,15).
What are the key properties of 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea?
3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea has a molecular weight of 238.36 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-sulfanyl-1-(2,4,5-trimethylphenyl)urea is sourced from PubChem (CID 88791451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).