About methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione
methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione (PubChem CID 88791561) has the molecular formula C8H8ClNO4
and a molecular weight of 217.61 g/mol. Its IUPAC name is methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione |
| PubChem CID | 88791561 |
| Molecular Formula | C8H8ClNO4 |
| Molecular Weight | 217.61 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione |
| SMILES | C=C(Cl)C(=O)OC.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H5ClO2.C4H3NO2/c1-3(5)4(6)7-2;6-3-1-2-4(7)5-3/h1H2,2H3;1-2H,(H,5,6,7) |
| InChIKey | WAPURQDHNWPELU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.61 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione?
The IUPAC name of methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione (CID 88791561) is methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione.
What is the SMILES notation for methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione?
The canonical SMILES for methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione is C=C(Cl)C(=O)OC.O=C1C=CC(=O)N1.
What is the InChIKey of methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione?
The InChIKey is WAPURQDHNWPELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO2.C4H3NO2/c1-3(5)4(6)7-2;6-3-1-2-4(7)5-3/h1H2,2H3;1-2H,(H,5,6,7).
What are the key properties of methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione?
methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione has a molecular weight of 217.61 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloroprop-2-enoate;pyrrole-2,5-dione is sourced from PubChem (CID 88791561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).