C7H15N3O5S — CID 88791757
methyl 3-(methanesulfonamidocarbamoylamino)-2-methylpropanoate (PubChem CID 88791757) has the molecular formula C7H15N3O5S and a molecular weight of 253.28 g/mol. Its IUPAC name is methyl 3-(methanesulfonamidocarbamoylamino)-2-methylpropanoate.
| Compound Name | methyl 3-(methanesulfonamidocarbamoylamino)-2-methylpropanoate |
|---|---|
| PubChem CID | 88791757 |
| Molecular Formula | C7H15N3O5S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | methyl 3-(methanesulfonamidocarbamoylamino)-2-methylpropanoate |
| SMILES | COC(=O)C(C)CNC(=O)NNS(C)(=O)=O |
| InChI | InChI=1S/C7H15N3O5S/c1-5(6(11)15-2)4-8-7(12)9-10-16(3,13)14/h5,10H,4H2,1-3H3,(H2,8,9,12) |
| InChIKey | BUVOUSVSWNCOME-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|