About dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate
dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate (PubChem CID 88791903) has the molecular formula C12H10K2N2O3
and a molecular weight of 308.42 g/mol. Its IUPAC name is dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate.
Molecular Properties
| Compound Name | dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate |
| PubChem CID | 88791903 |
| Molecular Formula | C12H10K2N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate |
| SMILES | CCC1(c2ccccc2)C(=O)N=C([O-])N=C1[O-].[K+].[K+] |
| InChI | InChI=1S/C12H12N2O3.2K/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;;/h3-7H,2H2,1H3,(H2,13,14,15,16,17);;/q;2*+1/p-2 |
| InChIKey | ZDEDEPOUNYEKNT-UHFFFAOYSA-L |
| XLogP | -6.64 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate?
The IUPAC name of dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate (CID 88791903) is dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate.
What is the SMILES notation for dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate?
The canonical SMILES for dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate is CCC1(c2ccccc2)C(=O)N=C([O-])N=C1[O-].[K+].[K+].
What is the InChIKey of dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate?
The InChIKey is ZDEDEPOUNYEKNT-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H12N2O3.2K/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;;/h3-7H,2H2,1H3,(H2,13,14,15,16,17);;/q;2*+1/p-2.
What are the key properties of dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate?
dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate has a molecular weight of 308.42 g/mol, XLogP of -6.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;5-ethyl-6-oxo-5-phenylpyrimidine-2,4-diolate is sourced from PubChem (CID 88791903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).