C12H14N2S — CID 88792381
1,2,3,6,7,7a-hexahydropyrazino[2,1-a]isoquinoline-4-thione (PubChem CID 88792381) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1,2,3,6,7,7a-hexahydropyrazino[2,1-a]isoquinoline-4-thione.
| Compound Name | 1,2,3,6,7,7a-hexahydropyrazino[2,1-a]isoquinoline-4-thione |
|---|---|
| PubChem CID | 88792381 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1,2,3,6,7,7a-hexahydropyrazino[2,1-a]isoquinoline-4-thione |
| SMILES | S=C1CNCC2=C3C=CC=CC3CCN12 |
| InChI | InChI=1S/C12H14N2S/c15-12-8-13-7-11-10-4-2-1-3-9(10)5-6-14(11)12/h1-4,9,13H,5-8H2 |
| InChIKey | OBXQPUZQZNBUIQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|