C32H61N8O3P — CID 88792557
6-[ethoxy-(2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphoryl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 88792557) has the molecular formula C32H61N8O3P and a molecular weight of 636.87 g/mol. Its IUPAC name is 6-[ethoxy-(2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphoryl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[ethoxy-(2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphoryl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 88792557 |
| Molecular Formula | C32H61N8O3P |
| Molecular Weight | 636.87 g/mol |
| Exact Mass | 636.46 |
| IUPAC Name | 6-[ethoxy-(2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphoryl]-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOP(=O)(OC1CC(C)(C)NC(C)(C)C1)c1nc(NC2CC(C)(C)NC(C)(C)C2)nc(NC2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C32H61N8O3P/c1-14-42-44(41,43-23-19-31(10,11)40-32(12,13)20-23)26-36-24(33-21-15-27(2,3)38-28(4,5)16-21)35-25(37-26)34-22-17-29(6,7)39-30(8,9)18-22/h21-23,38-40H,14-20H2,1-13H3,(H2,33,34,35,36,37) |
| InChIKey | XADLQSIYPNSWJA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.87 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|