C21H21NO4S — CID 88792652
methyl 2-[4-(dimethylcarbamoylsulfanyl)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetate (PubChem CID 88792652) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl 2-[4-(dimethylcarbamoylsulfanyl)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetate.
| Compound Name | methyl 2-[4-(dimethylcarbamoylsulfanyl)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetate |
|---|---|
| PubChem CID | 88792652 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | methyl 2-[4-(dimethylcarbamoylsulfanyl)-2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetate |
| SMILES | COC(=O)Cc1cc2c(c(SC(=O)N(C)C)c1)C(=O)c1ccccc1CC2 |
| InChI | InChI=1S/C21H21NO4S/c1-22(2)21(25)27-17-11-13(12-18(23)26-3)10-15-9-8-14-6-4-5-7-16(14)20(24)19(15)17/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | ZCZJLWPTEFHKCW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|