About oxiran-2-ylmethyl (E)-5-methylhept-4-enoate
oxiran-2-ylmethyl (E)-5-methylhept-4-enoate (PubChem CID 88792736) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is oxiran-2-ylmethyl (E)-5-methylhept-4-enoate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl (E)-5-methylhept-4-enoate |
| PubChem CID | 88792736 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | oxiran-2-ylmethyl (E)-5-methylhept-4-enoate |
| SMILES | CC/C(C)=C/CCC(=O)OCC1CO1 |
| InChI | InChI=1S/C11H18O3/c1-3-9(2)5-4-6-11(12)14-8-10-7-13-10/h5,10H,3-4,6-8H2,1-2H3/b9-5+ |
| InChIKey | ROMIPVDZPIGRIK-WEVVVXLNSA-N |
| XLogP | 2.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl (E)-5-methylhept-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl (E)-5-methylhept-4-enoate?
The IUPAC name of oxiran-2-ylmethyl (E)-5-methylhept-4-enoate (CID 88792736) is oxiran-2-ylmethyl (E)-5-methylhept-4-enoate.
What is the SMILES notation for oxiran-2-ylmethyl (E)-5-methylhept-4-enoate?
The canonical SMILES for oxiran-2-ylmethyl (E)-5-methylhept-4-enoate is CC/C(C)=C/CCC(=O)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl (E)-5-methylhept-4-enoate?
The InChIKey is ROMIPVDZPIGRIK-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-9(2)5-4-6-11(12)14-8-10-7-13-10/h5,10H,3-4,6-8H2,1-2H3/b9-5+.
What are the key properties of oxiran-2-ylmethyl (E)-5-methylhept-4-enoate?
oxiran-2-ylmethyl (E)-5-methylhept-4-enoate has a molecular weight of 198.26 g/mol, XLogP of 2.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl (E)-5-methylhept-4-enoate is sourced from PubChem (CID 88792736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).